C21H25NO3 — CID 91777127
[3-(2-methoxyphenyl)phenyl]-(3-propylmorpholin-4-yl)methanone (PubChem CID 91777127) has the molecular formula C21H25NO3 and a molecular weight of 339.44 g/mol. Its IUPAC name is [3-(2-methoxyphenyl)phenyl]-(3-propylmorpholin-4-yl)methanone.
| Compound Name | [3-(2-methoxyphenyl)phenyl]-(3-propylmorpholin-4-yl)methanone |
|---|---|
| PubChem CID | 91777127 |
| Molecular Formula | C21H25NO3 |
| Molecular Weight | 339.44 g/mol |
| Exact Mass | 339.18 |
| IUPAC Name | [3-(2-methoxyphenyl)phenyl]-(3-propylmorpholin-4-yl)methanone |
| SMILES | CCCC1COCCN1C(=O)c1cccc(-c2ccccc2OC)c1 |
| InChI | InChI=1S/C21H25NO3/c1-3-7-18-15-25-13-12-22(18)21(23)17-9-6-8-16(14-17)19-10-4-5-11-20(19)24-2/h4-6,8-11,14,18H,3,7,12-13,15H2,1-2H3 |
| InChIKey | GDNLQJRRBCKRPV-UHFFFAOYSA-N |
| XLogP | 4.00 |
| TPSA | 38.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.44 |
| LogP ≤ 5 | 4.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |