3-(2-methoxyphenyl)benzoic acid

C14H12O3 — CID 2759547

IUPAC3-(2-methoxyphenyl)benzoic acid
SMILESCOc1ccccc1-c1cccc(C(=O)O)c1
InChIInChI=1S/C14H12O3/c1-17-13-8-3-2-7-12(13)10-5-4-6-11(9-10)14(15)16/h2-9H,1H3,(H,15,16)
InChIKeyCOUUHAJQLHMNJM-UHFFFAOYSA-N
MW228.25 g/mol
LogP3.06
Rot. Bonds3

About 3-(2-methoxyphenyl)benzoic acid

3-(2-methoxyphenyl)benzoic acid (PubChem CID 2759547) has the molecular formula C14H12O3 and a molecular weight of 228.25 g/mol. Its IUPAC name is 3-(2-methoxyphenyl)benzoic acid.

Molecular Properties

Compound Name3-(2-methoxyphenyl)benzoic acid
PubChem CID2759547
Molecular FormulaC14H12O3
Molecular Weight228.25 g/mol
Exact Mass228.08
IUPAC Name3-(2-methoxyphenyl)benzoic acid
SMILESCOc1ccccc1-c1cccc(C(=O)O)c1
InChIInChI=1S/C14H12O3/c1-17-13-8-3-2-7-12(13)10-5-4-6-11(9-10)14(15)16/h2-9H,1H3,(H,15,16)
InChIKeyCOUUHAJQLHMNJM-UHFFFAOYSA-N
XLogP3.06
TPSA46.53 Ų
H-Bond Donors1
H-Bond Acceptors2
Rotatable Bonds3
Heavy Atoms17
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500228.25
LogP ≤ 53.06
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 102

Analyze 3-(2-methoxyphenyl)benzoic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Related Compounds

3-(2-fluoro-3-methoxyphenyl)benzoic acid
CID 53216650
1-[3-(2-methoxyphenyl)phenyl]-2-methylpropan-1-one
CID 82120149
3-hydroxy-5-(2-methoxyphenyl)benzoic acid
CID 53225397
3-chloro-5-(2-methoxyphenyl)benzoic acid
CID 53225406
methyl (E)-3-[3-(2-methoxyphenyl)phenyl]but-2-enoate
CID 82543553
3-(3-hydroxyphenyl)-4-methoxybenzoic acid
CID 115045204
3-(3-methoxy-4-methylphenyl)benzoic acid
CID 53216637
3-(2-hydroxyphenyl)benzoic acid;hydrochloride
CID 174448662
3-(3-fluorophenyl)-4-methoxybenzoic acid
CID 39349091
3-(3-bromophenyl)-4-methoxybenzoic acid
CID 115503797
2-methoxy-6-(2-methoxyphenyl)benzoic acid
CID 22380946
4-amino-3-(2-methoxyphenyl)benzoic acid
CID 82293590

Frequently Asked Questions

What is the IUPAC name of 3-(2-methoxyphenyl)benzoic acid?
The IUPAC name of 3-(2-methoxyphenyl)benzoic acid (CID 2759547) is 3-(2-methoxyphenyl)benzoic acid.
What is the SMILES notation for 3-(2-methoxyphenyl)benzoic acid?
The canonical SMILES for 3-(2-methoxyphenyl)benzoic acid is COc1ccccc1-c1cccc(C(=O)O)c1.
What is the InChIKey of 3-(2-methoxyphenyl)benzoic acid?
The InChIKey is COUUHAJQLHMNJM-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H12O3/c1-17-13-8-3-2-7-12(13)10-5-4-6-11(9-10)14(15)16/h2-9H,1H3,(H,15,16).
What are the key properties of 3-(2-methoxyphenyl)benzoic acid?
3-(2-methoxyphenyl)benzoic acid has a molecular weight of 228.25 g/mol, XLogP of 3.06, 3 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(2-methoxyphenyl)benzoic acid is sourced from PubChem (CID 2759547), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).