2-methoxy-6-(2-methoxyphenyl)benzoic acid

C15H14O4 — CID 22380946

IUPAC2-methoxy-6-(2-methoxyphenyl)benzoic acid
SMILESCOc1ccccc1-c1cccc(OC)c1C(=O)O
InChIInChI=1S/C15H14O4/c1-18-12-8-4-3-6-10(12)11-7-5-9-13(19-2)14(11)15(16)17/h3-9H,1-2H3,(H,16,17)
InChIKeyWPWLMHLGEMNQHW-UHFFFAOYSA-N
MW258.27 g/mol
LogP3.07
Rot. Bonds4

About 2-methoxy-6-(2-methoxyphenyl)benzoic acid

2-methoxy-6-(2-methoxyphenyl)benzoic acid (PubChem CID 22380946) has the molecular formula C15H14O4 and a molecular weight of 258.27 g/mol. Its IUPAC name is 2-methoxy-6-(2-methoxyphenyl)benzoic acid.

Molecular Properties

Compound Name2-methoxy-6-(2-methoxyphenyl)benzoic acid
PubChem CID22380946
Molecular FormulaC15H14O4
Molecular Weight258.27 g/mol
Exact Mass258.09
IUPAC Name2-methoxy-6-(2-methoxyphenyl)benzoic acid
SMILESCOc1ccccc1-c1cccc(OC)c1C(=O)O
InChIInChI=1S/C15H14O4/c1-18-12-8-4-3-6-10(12)11-7-5-9-13(19-2)14(11)15(16)17/h3-9H,1-2H3,(H,16,17)
InChIKeyWPWLMHLGEMNQHW-UHFFFAOYSA-N
XLogP3.07
TPSA55.76 Ų
H-Bond Donors1
H-Bond Acceptors3
Rotatable Bonds4
Heavy Atoms19
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500258.27
LogP ≤ 53.07
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 103

Analyze 2-methoxy-6-(2-methoxyphenyl)benzoic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Related Compounds

2-[2-(2-methoxyphenyl)phenyl]benzoic acid
CID 67896375
2-methoxy-3-(2-methoxyphenyl)benzoic acid
CID 53225402
3-(2-methoxyphenyl)-2-nitrobenzoic acid
CID 141393967
3-(2-methoxyphenyl)benzoic acid
CID 2759547
5-(2-methoxyphenyl)-1H-pyrrole-2-carboxylic acid
CID 22507236
2-amino-6-methoxybenzoic acid;hydrochloride
CID 46735179
5-chloro-2-(2-methoxyphenyl)benzoic acid
CID 39232682
7-(2-methoxyphenyl)-1-benzothiophene-2-carboxylic acid
CID 90141254
1-hydroxy-4-(2-methoxyphenyl)naphthalene-2-carboxylic acid
CID 174552806
4-chloro-2-(2-methoxyphenyl)benzoic acid
CID 53225407
4-amino-3-(2-methoxyphenyl)benzoic acid
CID 82293590
4-(2-methoxyphenyl)-1-methylpyrazole-3-carboxylic acid
CID 83645102

Frequently Asked Questions

What is the IUPAC name of 2-methoxy-6-(2-methoxyphenyl)benzoic acid?
The IUPAC name of 2-methoxy-6-(2-methoxyphenyl)benzoic acid (CID 22380946) is 2-methoxy-6-(2-methoxyphenyl)benzoic acid.
What is the SMILES notation for 2-methoxy-6-(2-methoxyphenyl)benzoic acid?
The canonical SMILES for 2-methoxy-6-(2-methoxyphenyl)benzoic acid is COc1ccccc1-c1cccc(OC)c1C(=O)O.
What is the InChIKey of 2-methoxy-6-(2-methoxyphenyl)benzoic acid?
The InChIKey is WPWLMHLGEMNQHW-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H14O4/c1-18-12-8-4-3-6-10(12)11-7-5-9-13(19-2)14(11)15(16)17/h3-9H,1-2H3,(H,16,17).
What are the key properties of 2-methoxy-6-(2-methoxyphenyl)benzoic acid?
2-methoxy-6-(2-methoxyphenyl)benzoic acid has a molecular weight of 258.27 g/mol, XLogP of 3.07, 4 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-methoxy-6-(2-methoxyphenyl)benzoic acid is sourced from PubChem (CID 22380946), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).