2-[2-(2-methoxyphenyl)phenyl]benzoic acid

C20H16O3 — CID 67896375

IUPAC2-[2-(2-methoxyphenyl)phenyl]benzoic acid
SMILESCOc1ccccc1-c1ccccc1-c1ccccc1C(=O)O
InChIInChI=1S/C20H16O3/c1-23-19-13-7-6-11-17(19)15-9-3-2-8-14(15)16-10-4-5-12-18(16)20(21)22/h2-13H,1H3,(H,21,22)
InChIKeyGFVDDKJDRGRWNZ-UHFFFAOYSA-N
MW304.35 g/mol
LogP4.73
Rot. Bonds4

About 2-[2-(2-methoxyphenyl)phenyl]benzoic acid

2-[2-(2-methoxyphenyl)phenyl]benzoic acid (PubChem CID 67896375) has the molecular formula C20H16O3 and a molecular weight of 304.35 g/mol. Its IUPAC name is 2-[2-(2-methoxyphenyl)phenyl]benzoic acid.

Molecular Properties

Compound Name2-[2-(2-methoxyphenyl)phenyl]benzoic acid
PubChem CID67896375
Molecular FormulaC20H16O3
Molecular Weight304.35 g/mol
Exact Mass304.11
IUPAC Name2-[2-(2-methoxyphenyl)phenyl]benzoic acid
SMILESCOc1ccccc1-c1ccccc1-c1ccccc1C(=O)O
InChIInChI=1S/C20H16O3/c1-23-19-13-7-6-11-17(19)15-9-3-2-8-14(15)16-10-4-5-12-18(16)20(21)22/h2-13H,1H3,(H,21,22)
InChIKeyGFVDDKJDRGRWNZ-UHFFFAOYSA-N
XLogP4.73
TPSA46.53 Ų
H-Bond Donors1
H-Bond Acceptors2
Rotatable Bonds4
Heavy Atoms23
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500304.35
LogP ≤ 54.73
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 102

Analyze 2-[2-(2-methoxyphenyl)phenyl]benzoic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Related Compounds

2-methoxy-3-(2-methoxyphenyl)benzoic acid
CID 53225402
5-chloro-2-(2-methoxyphenyl)benzoic acid
CID 39232682
2-methoxy-6-(2-methoxyphenyl)benzoic acid
CID 22380946
4-chloro-2-(2-methoxyphenyl)benzoic acid
CID 53225407
3-(2-methoxyphenyl)-2-nitrobenzoic acid
CID 141393967
2-[[2,6-dichloro-3-(2-methoxyphenyl)phenyl]methyl]benzoic acid
CID 158374464
2-(2-carboxyphenyl)benzoic acid;cobalt
CID 159898458
1-hydroxy-4-(2-methoxyphenyl)naphthalene-2-carboxylic acid
CID 174552806
2-[3-(2-methoxyphenyl)-1,2,4-oxadiazol-5-yl]benzoic acid
CID 23008025
2-methoxybenzoic acid;bis(propan-2-ol)
CID 130236181
2-[2-(2-methylpropanoyl)phenyl]benzoic acid
CID 21063785
2-[2-(2-phenylphenyl)phenyl]benzoic acid
CID 141238749

Frequently Asked Questions

What is the IUPAC name of 2-[2-(2-methoxyphenyl)phenyl]benzoic acid?
The IUPAC name of 2-[2-(2-methoxyphenyl)phenyl]benzoic acid (CID 67896375) is 2-[2-(2-methoxyphenyl)phenyl]benzoic acid.
What is the SMILES notation for 2-[2-(2-methoxyphenyl)phenyl]benzoic acid?
The canonical SMILES for 2-[2-(2-methoxyphenyl)phenyl]benzoic acid is COc1ccccc1-c1ccccc1-c1ccccc1C(=O)O.
What is the InChIKey of 2-[2-(2-methoxyphenyl)phenyl]benzoic acid?
The InChIKey is GFVDDKJDRGRWNZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H16O3/c1-23-19-13-7-6-11-17(19)15-9-3-2-8-14(15)16-10-4-5-12-18(16)20(21)22/h2-13H,1H3,(H,21,22).
What are the key properties of 2-[2-(2-methoxyphenyl)phenyl]benzoic acid?
2-[2-(2-methoxyphenyl)phenyl]benzoic acid has a molecular weight of 304.35 g/mol, XLogP of 4.73, 4 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[2-(2-methoxyphenyl)phenyl]benzoic acid is sourced from PubChem (CID 67896375), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).