About 2-(2-carboxyphenyl)benzoic acid;cobalt
2-(2-carboxyphenyl)benzoic acid;cobalt (PubChem CID 159898458) has the molecular formula C14H10CoO4
and a molecular weight of 301.16 g/mol. Its IUPAC name is 2-(2-carboxyphenyl)benzoic acid;cobalt.
Molecular Properties
| Compound Name | 2-(2-carboxyphenyl)benzoic acid;cobalt |
| PubChem CID | 159898458 |
| Molecular Formula | C14H10CoO4 |
| Molecular Weight | 301.16 g/mol |
| Exact Mass | 300.99 |
| IUPAC Name | 2-(2-carboxyphenyl)benzoic acid;cobalt |
| SMILES | O=C(O)c1ccccc1-c1ccccc1C(=O)O.[Co] |
| InChI | InChI=1S/C14H10O4.Co/c15-13(16)11-7-3-1-5-9(11)10-6-2-4-8-12(10)14(17)18;/h1-8H,(H,15,16)(H,17,18); |
| InChIKey | NVQNFRJFCJRNJC-UHFFFAOYSA-N |
| XLogP | 2.75 |
| TPSA | 74.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 301.16 |
| LogP ≤ 5 | 2.75 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 2-(2-carboxyphenyl)benzoic acid;cobalt with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(2-carboxyphenyl)benzoic acid;cobalt?
The IUPAC name of 2-(2-carboxyphenyl)benzoic acid;cobalt (CID 159898458) is 2-(2-carboxyphenyl)benzoic acid;cobalt.
What is the SMILES notation for 2-(2-carboxyphenyl)benzoic acid;cobalt?
The canonical SMILES for 2-(2-carboxyphenyl)benzoic acid;cobalt is O=C(O)c1ccccc1-c1ccccc1C(=O)O.[Co].
What is the InChIKey of 2-(2-carboxyphenyl)benzoic acid;cobalt?
The InChIKey is NVQNFRJFCJRNJC-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H10O4.Co/c15-13(16)11-7-3-1-5-9(11)10-6-2-4-8-12(10)14(17)18;/h1-8H,(H,15,16)(H,17,18);.
What are the key properties of 2-(2-carboxyphenyl)benzoic acid;cobalt?
2-(2-carboxyphenyl)benzoic acid;cobalt has a molecular weight of 301.16 g/mol, XLogP of 2.75, 3 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(2-carboxyphenyl)benzoic acid;cobalt is sourced from PubChem (CID 159898458), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).