About hydron;phthalic acid
hydron;phthalic acid (PubChem CID 67386665) has the molecular formula C8H12O4+6
and a molecular weight of 172.18 g/mol. Its IUPAC name is hydron;phthalic acid.
Molecular Properties
| Compound Name | hydron;phthalic acid |
| PubChem CID | 67386665 |
| Molecular Formula | C8H12O4+6 |
| Molecular Weight | 172.18 g/mol |
| Exact Mass | 172.07 |
| IUPAC Name | hydron;phthalic acid |
| SMILES | O=C(O)c1ccccc1C(=O)O.[H+].[H+].[H+].[H+].[H+].[H+] |
| InChI | InChI=1S/C8H6O4/c9-7(10)5-3-1-2-4-6(5)8(11)12/h1-4H,(H,9,10)(H,11,12)/p+6 |
| InChIKey | XNGIFLGASWRNHJ-UHFFFAOYSA-T |
| XLogP | 1.76 |
| TPSA | 74.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 172.18 |
| LogP ≤ 5 | 1.76 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze hydron;phthalic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of hydron;phthalic acid?
The IUPAC name of hydron;phthalic acid (CID 67386665) is hydron;phthalic acid.
What is the SMILES notation for hydron;phthalic acid?
The canonical SMILES for hydron;phthalic acid is O=C(O)c1ccccc1C(=O)O.[H+].[H+].[H+].[H+].[H+].[H+].
What is the InChIKey of hydron;phthalic acid?
The InChIKey is XNGIFLGASWRNHJ-UHFFFAOYSA-T. The full InChI is InChI=1S/C8H6O4/c9-7(10)5-3-1-2-4-6(5)8(11)12/h1-4H,(H,9,10)(H,11,12)/p+6.
What are the key properties of hydron;phthalic acid?
hydron;phthalic acid has a molecular weight of 172.18 g/mol, XLogP of 1.76, 2 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for hydron;phthalic acid is sourced from PubChem (CID 67386665), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).