About azane;phthalic acid;hydrochloride
azane;phthalic acid;hydrochloride (PubChem CID 175440203) has the molecular formula C8H16ClN3O4
and a molecular weight of 253.69 g/mol. Its IUPAC name is azane;phthalic acid;hydrochloride.
Molecular Properties
| Compound Name | azane;phthalic acid;hydrochloride |
| PubChem CID | 175440203 |
| Molecular Formula | C8H16ClN3O4 |
| Molecular Weight | 253.69 g/mol |
| Exact Mass | 253.08 |
| IUPAC Name | azane;phthalic acid;hydrochloride |
| SMILES | Cl.N.N.N.O=C(O)c1ccccc1C(=O)O |
| InChI | InChI=1S/C8H6O4.ClH.3H3N/c9-7(10)5-3-1-2-4-6(5)8(11)12;;;;/h1-4H,(H,9,10)(H,11,12);1H;3*1H3 |
| InChIKey | RNDVWASRPMZYLW-UHFFFAOYSA-N |
| XLogP | 1.99 |
| TPSA | 179.60 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 253.69 |
| LogP ≤ 5 | 1.99 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze azane;phthalic acid;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of azane;phthalic acid;hydrochloride?
The IUPAC name of azane;phthalic acid;hydrochloride (CID 175440203) is azane;phthalic acid;hydrochloride.
What is the SMILES notation for azane;phthalic acid;hydrochloride?
The canonical SMILES for azane;phthalic acid;hydrochloride is Cl.N.N.N.O=C(O)c1ccccc1C(=O)O.
What is the InChIKey of azane;phthalic acid;hydrochloride?
The InChIKey is RNDVWASRPMZYLW-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H6O4.ClH.3H3N/c9-7(10)5-3-1-2-4-6(5)8(11)12;;;;/h1-4H,(H,9,10)(H,11,12);1H;3*1H3.
What are the key properties of azane;phthalic acid;hydrochloride?
azane;phthalic acid;hydrochloride has a molecular weight of 253.69 g/mol, XLogP of 1.99, 2 rotatable bonds, 5 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for azane;phthalic acid;hydrochloride is sourced from PubChem (CID 175440203), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).