About phthalic acid;hydrobromide
phthalic acid;hydrobromide (PubChem CID 71236392) has the molecular formula C8H7BrO4
and a molecular weight of 247.04 g/mol. Its IUPAC name is phthalic acid;hydrobromide.
Molecular Properties
| Compound Name | phthalic acid;hydrobromide |
| PubChem CID | 71236392 |
| Molecular Formula | C8H7BrO4 |
| Molecular Weight | 247.04 g/mol |
| Exact Mass | 245.95 |
| IUPAC Name | phthalic acid;hydrobromide |
| SMILES | Br.O=C(O)c1ccccc1C(=O)O |
| InChI | InChI=1S/C8H6O4.BrH/c9-7(10)5-3-1-2-4-6(5)8(11)12;/h1-4H,(H,9,10)(H,11,12);1H |
| InChIKey | DYWGEVDXJIYDCC-UHFFFAOYSA-N |
| XLogP | 1.66 |
| TPSA | 74.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 247.04 |
| LogP ≤ 5 | 1.66 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze phthalic acid;hydrobromide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of phthalic acid;hydrobromide?
The IUPAC name of phthalic acid;hydrobromide (CID 71236392) is phthalic acid;hydrobromide.
What is the SMILES notation for phthalic acid;hydrobromide?
The canonical SMILES for phthalic acid;hydrobromide is Br.O=C(O)c1ccccc1C(=O)O.
What is the InChIKey of phthalic acid;hydrobromide?
The InChIKey is DYWGEVDXJIYDCC-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H6O4.BrH/c9-7(10)5-3-1-2-4-6(5)8(11)12;/h1-4H,(H,9,10)(H,11,12);1H.
What are the key properties of phthalic acid;hydrobromide?
phthalic acid;hydrobromide has a molecular weight of 247.04 g/mol, XLogP of 1.66, 2 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for phthalic acid;hydrobromide is sourced from PubChem (CID 71236392), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).