2-[3,5-bis(2-carboxyphenyl)phenyl]benzoic acid

C27H18O6 — CID 21428532

IUPAC2-[3,5-bis(2-carboxyphenyl)phenyl]benzoic acid
SMILESO=C(O)c1ccccc1-c1cc(-c2ccccc2C(=O)O)cc(-c2ccccc2C(=O)O)c1
InChIInChI=1S/C27H18O6/c28-25(29)22-10-4-1-7-19(22)16-13-17(20-8-2-5-11-23(20)26(30)31)15-18(14-16)21-9-3-6-12-24(21)27(32)33/h1-15H,(H,28,29)(H,30,31)(H,32,33)
InChIKeySVAJWMFPXLZPHL-UHFFFAOYSA-N
MW438.44 g/mol
LogP5.78
Rot. Bonds6

About 2-[3,5-bis(2-carboxyphenyl)phenyl]benzoic acid

2-[3,5-bis(2-carboxyphenyl)phenyl]benzoic acid (PubChem CID 21428532) has the molecular formula C27H18O6 and a molecular weight of 438.44 g/mol. Its IUPAC name is 2-[3,5-bis(2-carboxyphenyl)phenyl]benzoic acid.

Molecular Properties

Compound Name2-[3,5-bis(2-carboxyphenyl)phenyl]benzoic acid
PubChem CID21428532
Molecular FormulaC27H18O6
Molecular Weight438.44 g/mol
Exact Mass438.11
IUPAC Name2-[3,5-bis(2-carboxyphenyl)phenyl]benzoic acid
SMILESO=C(O)c1ccccc1-c1cc(-c2ccccc2C(=O)O)cc(-c2ccccc2C(=O)O)c1
InChIInChI=1S/C27H18O6/c28-25(29)22-10-4-1-7-19(22)16-13-17(20-8-2-5-11-23(20)26(30)31)15-18(14-16)21-9-3-6-12-24(21)27(32)33/h1-15H,(H,28,29)(H,30,31)(H,32,33)
InChIKeySVAJWMFPXLZPHL-UHFFFAOYSA-N
XLogP5.78
TPSA111.90 Ų
H-Bond Donors3
H-Bond Acceptors3
Rotatable Bonds6
Heavy Atoms33
Complexity—

Lipinski Rule of Five

1 violation

RuleValue
MW ≤ 500438.44
LogP ≤ 55.78
H-Bond Donors ≤ 53
H-Bond Acceptors ≤ 103

Analyze 2-[3,5-bis(2-carboxyphenyl)phenyl]benzoic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Related Compounds

5-(2-carboxyphenyl)benzene-1,3-dicarboxylic acid
CID 53218447
acetylene;2-phenylbenzoic acid
CID 67726329
2-(2-carboxyphenyl)benzoic acid;cobalt
CID 159898458
2-[3,4-bis(2-carboxyphenyl)phenyl]benzoic acid
CID 154122846
2,5-bis(2-carboxyphenyl)terephthalic acid
CID 15619214
2-[2-(2-phenylphenyl)phenyl]benzoic acid
CID 141238749
2-(4-phosphanylphenyl)benzoic acid
CID 58612433
benzoic acid;ethane;bis(2-phenylbenzoic acid)
CID 158851382
4-(2-carboxyphenyl)-2-(4-carboxyphenyl)benzoic acid
CID 102275934
benzene-1,2,4,5-tetracarboxylic acid;phthalic acid
CID 174433443
2-(2-carboxyphenyl)benzene-1,3-dicarboxylic acid
CID 101121393
2-(3-acetylphenyl)benzoic acid
CID 2756265

Frequently Asked Questions

What is the IUPAC name of 2-[3,5-bis(2-carboxyphenyl)phenyl]benzoic acid?
The IUPAC name of 2-[3,5-bis(2-carboxyphenyl)phenyl]benzoic acid (CID 21428532) is 2-[3,5-bis(2-carboxyphenyl)phenyl]benzoic acid.
What is the SMILES notation for 2-[3,5-bis(2-carboxyphenyl)phenyl]benzoic acid?
The canonical SMILES for 2-[3,5-bis(2-carboxyphenyl)phenyl]benzoic acid is O=C(O)c1ccccc1-c1cc(-c2ccccc2C(=O)O)cc(-c2ccccc2C(=O)O)c1.
What is the InChIKey of 2-[3,5-bis(2-carboxyphenyl)phenyl]benzoic acid?
The InChIKey is SVAJWMFPXLZPHL-UHFFFAOYSA-N. The full InChI is InChI=1S/C27H18O6/c28-25(29)22-10-4-1-7-19(22)16-13-17(20-8-2-5-11-23(20)26(30)31)15-18(14-16)21-9-3-6-12-24(21)27(32)33/h1-15H,(H,28,29)(H,30,31)(H,32,33).
What are the key properties of 2-[3,5-bis(2-carboxyphenyl)phenyl]benzoic acid?
2-[3,5-bis(2-carboxyphenyl)phenyl]benzoic acid has a molecular weight of 438.44 g/mol, XLogP of 5.78, 6 rotatable bonds, 3 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[3,5-bis(2-carboxyphenyl)phenyl]benzoic acid is sourced from PubChem (CID 21428532), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).