3-(3-fluorophenyl)-4-methoxybenzoic acid

C14H11FO3 — CID 39349091

IUPAC3-(3-fluorophenyl)-4-methoxybenzoic acid
SMILESCOc1ccc(C(=O)O)cc1-c1cccc(F)c1
InChIInChI=1S/C14H11FO3/c1-18-13-6-5-10(14(16)17)8-12(13)9-3-2-4-11(15)7-9/h2-8H,1H3,(H,16,17)
InChIKeyIRFXRORTZAGOBD-UHFFFAOYSA-N
MW246.24 g/mol
LogP3.20
Rot. Bonds3

About 3-(3-fluorophenyl)-4-methoxybenzoic acid

3-(3-fluorophenyl)-4-methoxybenzoic acid (PubChem CID 39349091) has the molecular formula C14H11FO3 and a molecular weight of 246.24 g/mol. Its IUPAC name is 3-(3-fluorophenyl)-4-methoxybenzoic acid.

Molecular Properties

Compound Name3-(3-fluorophenyl)-4-methoxybenzoic acid
PubChem CID39349091
Molecular FormulaC14H11FO3
Molecular Weight246.24 g/mol
Exact Mass246.07
IUPAC Name3-(3-fluorophenyl)-4-methoxybenzoic acid
SMILESCOc1ccc(C(=O)O)cc1-c1cccc(F)c1
InChIInChI=1S/C14H11FO3/c1-18-13-6-5-10(14(16)17)8-12(13)9-3-2-4-11(15)7-9/h2-8H,1H3,(H,16,17)
InChIKeyIRFXRORTZAGOBD-UHFFFAOYSA-N
XLogP3.20
TPSA46.53 Ų
H-Bond Donors1
H-Bond Acceptors2
Rotatable Bonds3
Heavy Atoms18
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500246.24
LogP ≤ 53.20
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 102

Analyze 3-(3-fluorophenyl)-4-methoxybenzoic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Related Compounds

1-[3-(3-fluorophenyl)-4-methoxyphenyl]ethanone
CID 82541241
3-(3-hydroxyphenyl)-4-methoxybenzoic acid
CID 115045204
3-(3-bromophenyl)-4-methoxybenzoic acid
CID 115503797
4-fluoro-3-(3-fluorophenyl)benzoic acid
CID 46312321
3-[3-[(dimethylamino)methyl]phenyl]-4-methoxybenzoic acid
CID 82039455
4-methoxy-3-(2,4,6-trifluorophenyl)benzoic acid
CID 61025742
3-(2-methoxyphenyl)benzoic acid
CID 2759547
3-(2-fluoro-3-methoxyphenyl)benzoic acid
CID 53216650
3-[3-fluoro-4-(2-iodoethoxy)phenyl]-4-methoxybenzoic acid
CID 148556940
4-fluoro-3-(3-hydroxy-4-methoxyphenyl)benzoic acid
CID 53220977
3-[(3-fluorobenzoyl)amino]-4-methoxybenzoic acid
CID 28667508
methyl 4-methoxy-3-phenylbenzoate
CID 11010121

Frequently Asked Questions

What is the IUPAC name of 3-(3-fluorophenyl)-4-methoxybenzoic acid?
The IUPAC name of 3-(3-fluorophenyl)-4-methoxybenzoic acid (CID 39349091) is 3-(3-fluorophenyl)-4-methoxybenzoic acid.
What is the SMILES notation for 3-(3-fluorophenyl)-4-methoxybenzoic acid?
The canonical SMILES for 3-(3-fluorophenyl)-4-methoxybenzoic acid is COc1ccc(C(=O)O)cc1-c1cccc(F)c1.
What is the InChIKey of 3-(3-fluorophenyl)-4-methoxybenzoic acid?
The InChIKey is IRFXRORTZAGOBD-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H11FO3/c1-18-13-6-5-10(14(16)17)8-12(13)9-3-2-4-11(15)7-9/h2-8H,1H3,(H,16,17).
What are the key properties of 3-(3-fluorophenyl)-4-methoxybenzoic acid?
3-(3-fluorophenyl)-4-methoxybenzoic acid has a molecular weight of 246.24 g/mol, XLogP of 3.20, 3 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(3-fluorophenyl)-4-methoxybenzoic acid is sourced from PubChem (CID 39349091), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).