4-methoxy-3-(2,4,6-trifluorophenyl)benzoic acid

C14H9F3O3 — CID 61025742

IUPAC4-methoxy-3-(2,4,6-trifluorophenyl)benzoic acid
SMILESCOc1ccc(C(=O)O)cc1-c1c(F)cc(F)cc1F
InChIInChI=1S/C14H9F3O3/c1-20-12-3-2-7(14(18)19)4-9(12)13-10(16)5-8(15)6-11(13)17/h2-6H,1H3,(H,18,19)
InChIKeyPPQYJKWKXNWIIR-UHFFFAOYSA-N
MW282.22 g/mol
LogP3.48
Rot. Bonds3

About 4-methoxy-3-(2,4,6-trifluorophenyl)benzoic acid

4-methoxy-3-(2,4,6-trifluorophenyl)benzoic acid (PubChem CID 61025742) has the molecular formula C14H9F3O3 and a molecular weight of 282.22 g/mol. Its IUPAC name is 4-methoxy-3-(2,4,6-trifluorophenyl)benzoic acid.

Molecular Properties

Compound Name4-methoxy-3-(2,4,6-trifluorophenyl)benzoic acid
PubChem CID61025742
Molecular FormulaC14H9F3O3
Molecular Weight282.22 g/mol
Exact Mass282.05
IUPAC Name4-methoxy-3-(2,4,6-trifluorophenyl)benzoic acid
SMILESCOc1ccc(C(=O)O)cc1-c1c(F)cc(F)cc1F
InChIInChI=1S/C14H9F3O3/c1-20-12-3-2-7(14(18)19)4-9(12)13-10(16)5-8(15)6-11(13)17/h2-6H,1H3,(H,18,19)
InChIKeyPPQYJKWKXNWIIR-UHFFFAOYSA-N
XLogP3.48
TPSA46.53 Ų
H-Bond Donors1
H-Bond Acceptors2
Rotatable Bonds3
Heavy Atoms20
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500282.22
LogP ≤ 53.48
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 102

Analyze 4-methoxy-3-(2,4,6-trifluorophenyl)benzoic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 4-methoxy-3-(2,4,6-trifluorophenyl)benzoic acid?
The IUPAC name of 4-methoxy-3-(2,4,6-trifluorophenyl)benzoic acid (CID 61025742) is 4-methoxy-3-(2,4,6-trifluorophenyl)benzoic acid.
What is the SMILES notation for 4-methoxy-3-(2,4,6-trifluorophenyl)benzoic acid?
The canonical SMILES for 4-methoxy-3-(2,4,6-trifluorophenyl)benzoic acid is COc1ccc(C(=O)O)cc1-c1c(F)cc(F)cc1F.
What is the InChIKey of 4-methoxy-3-(2,4,6-trifluorophenyl)benzoic acid?
The InChIKey is PPQYJKWKXNWIIR-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H9F3O3/c1-20-12-3-2-7(14(18)19)4-9(12)13-10(16)5-8(15)6-11(13)17/h2-6H,1H3,(H,18,19).
What are the key properties of 4-methoxy-3-(2,4,6-trifluorophenyl)benzoic acid?
4-methoxy-3-(2,4,6-trifluorophenyl)benzoic acid has a molecular weight of 282.22 g/mol, XLogP of 3.48, 3 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 4-methoxy-3-(2,4,6-trifluorophenyl)benzoic acid is sourced from PubChem (CID 61025742), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).