3-(2,6-difluoro-4-methoxyphenyl)-4-methoxybenzoic acid

C15H12F2O4 — CID 61026090

IUPAC3-(2,6-difluoro-4-methoxyphenyl)-4-methoxybenzoic acid
SMILESCOc1cc(F)c(-c2cc(C(=O)O)ccc2OC)c(F)c1
InChIInChI=1S/C15H12F2O4/c1-20-9-6-11(16)14(12(17)7-9)10-5-8(15(18)19)3-4-13(10)21-2/h3-7H,1-2H3,(H,18,19)
InChIKeyIVVLDESJRPXWPC-UHFFFAOYSA-N
MW294.25 g/mol
LogP3.35
Rot. Bonds4

About 3-(2,6-difluoro-4-methoxyphenyl)-4-methoxybenzoic acid

3-(2,6-difluoro-4-methoxyphenyl)-4-methoxybenzoic acid (PubChem CID 61026090) has the molecular formula C15H12F2O4 and a molecular weight of 294.25 g/mol. Its IUPAC name is 3-(2,6-difluoro-4-methoxyphenyl)-4-methoxybenzoic acid.

Molecular Properties

Compound Name3-(2,6-difluoro-4-methoxyphenyl)-4-methoxybenzoic acid
PubChem CID61026090
Molecular FormulaC15H12F2O4
Molecular Weight294.25 g/mol
Exact Mass294.07
IUPAC Name3-(2,6-difluoro-4-methoxyphenyl)-4-methoxybenzoic acid
SMILESCOc1cc(F)c(-c2cc(C(=O)O)ccc2OC)c(F)c1
InChIInChI=1S/C15H12F2O4/c1-20-9-6-11(16)14(12(17)7-9)10-5-8(15(18)19)3-4-13(10)21-2/h3-7H,1-2H3,(H,18,19)
InChIKeyIVVLDESJRPXWPC-UHFFFAOYSA-N
XLogP3.35
TPSA55.76 Ų
H-Bond Donors1
H-Bond Acceptors3
Rotatable Bonds4
Heavy Atoms21
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500294.25
LogP ≤ 53.35
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 103

Analyze 3-(2,6-difluoro-4-methoxyphenyl)-4-methoxybenzoic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 3-(2,6-difluoro-4-methoxyphenyl)-4-methoxybenzoic acid?
The IUPAC name of 3-(2,6-difluoro-4-methoxyphenyl)-4-methoxybenzoic acid (CID 61026090) is 3-(2,6-difluoro-4-methoxyphenyl)-4-methoxybenzoic acid.
What is the SMILES notation for 3-(2,6-difluoro-4-methoxyphenyl)-4-methoxybenzoic acid?
The canonical SMILES for 3-(2,6-difluoro-4-methoxyphenyl)-4-methoxybenzoic acid is COc1cc(F)c(-c2cc(C(=O)O)ccc2OC)c(F)c1.
What is the InChIKey of 3-(2,6-difluoro-4-methoxyphenyl)-4-methoxybenzoic acid?
The InChIKey is IVVLDESJRPXWPC-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H12F2O4/c1-20-9-6-11(16)14(12(17)7-9)10-5-8(15(18)19)3-4-13(10)21-2/h3-7H,1-2H3,(H,18,19).
What are the key properties of 3-(2,6-difluoro-4-methoxyphenyl)-4-methoxybenzoic acid?
3-(2,6-difluoro-4-methoxyphenyl)-4-methoxybenzoic acid has a molecular weight of 294.25 g/mol, XLogP of 3.35, 4 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(2,6-difluoro-4-methoxyphenyl)-4-methoxybenzoic acid is sourced from PubChem (CID 61026090), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).