C15H13FO4 — CID 53211675
4-(2,4-dimethoxyphenyl)-3-fluorobenzoic acid (PubChem CID 53211675) has the molecular formula C15H13FO4 and a molecular weight of 276.26 g/mol. Its IUPAC name is 4-(2,4-dimethoxyphenyl)-3-fluorobenzoic acid.
| Compound Name | 4-(2,4-dimethoxyphenyl)-3-fluorobenzoic acid |
|---|---|
| PubChem CID | 53211675 |
| Molecular Formula | C15H13FO4 |
| Molecular Weight | 276.26 g/mol |
| Exact Mass | 276.08 |
| IUPAC Name | 4-(2,4-dimethoxyphenyl)-3-fluorobenzoic acid |
| SMILES | COc1ccc(-c2ccc(C(=O)O)cc2F)c(OC)c1 |
| InChI | InChI=1S/C15H13FO4/c1-19-10-4-6-12(14(8-10)20-2)11-5-3-9(15(17)18)7-13(11)16/h3-8H,1-2H3,(H,17,18) |
| InChIKey | QCOIHKGJTSYEPP-UHFFFAOYSA-N |
| XLogP | 3.21 |
| TPSA | 55.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.26 |
| LogP ≤ 5 | 3.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |