C14H13FO3 — CID 53219547
4-(2,4-dimethoxyphenyl)-3-fluorophenol (PubChem CID 53219547) has the molecular formula C14H13FO3 and a molecular weight of 248.25 g/mol. Its IUPAC name is 4-(2,4-dimethoxyphenyl)-3-fluorophenol.
| Compound Name | 4-(2,4-dimethoxyphenyl)-3-fluorophenol |
|---|---|
| PubChem CID | 53219547 |
| Molecular Formula | C14H13FO3 |
| Molecular Weight | 248.25 g/mol |
| Exact Mass | 248.08 |
| IUPAC Name | 4-(2,4-dimethoxyphenyl)-3-fluorophenol |
| SMILES | COc1ccc(-c2ccc(O)cc2F)c(OC)c1 |
| InChI | InChI=1S/C14H13FO3/c1-17-10-4-6-12(14(8-10)18-2)11-5-3-9(16)7-13(11)15/h3-8,16H,1-2H3 |
| InChIKey | YTCDDPREFGFYIF-UHFFFAOYSA-N |
| XLogP | 3.22 |
| TPSA | 38.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 248.25 |
| LogP ≤ 5 | 3.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |