C16H18O5 — CID 165177874
2-(2,4-dimethoxyphenyl)-3,5-dimethoxyphenol (PubChem CID 165177874) has the molecular formula C16H18O5 and a molecular weight of 290.32 g/mol. Its IUPAC name is 2-(2,4-dimethoxyphenyl)-3,5-dimethoxyphenol.
| Compound Name | 2-(2,4-dimethoxyphenyl)-3,5-dimethoxyphenol |
|---|---|
| PubChem CID | 165177874 |
| Molecular Formula | C16H18O5 |
| Molecular Weight | 290.32 g/mol |
| Exact Mass | 290.12 |
| IUPAC Name | 2-(2,4-dimethoxyphenyl)-3,5-dimethoxyphenol |
| SMILES | COc1ccc(-c2c(O)cc(OC)cc2OC)c(OC)c1 |
| InChI | InChI=1S/C16H18O5/c1-18-10-5-6-12(14(8-10)20-3)16-13(17)7-11(19-2)9-15(16)21-4/h5-9,17H,1-4H3 |
| InChIKey | CFBOOFBKJGPIQL-UHFFFAOYSA-N |
| XLogP | 3.09 |
| TPSA | 57.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.32 |
| LogP ≤ 5 | 3.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |