C14H16ClNO3 — CID 22173838
3-amino-2-(2,4-dimethoxyphenyl)phenol;hydrochloride (PubChem CID 22173838) has the molecular formula C14H16ClNO3 and a molecular weight of 281.74 g/mol. Its IUPAC name is 3-amino-2-(2,4-dimethoxyphenyl)phenol;hydrochloride.
| Compound Name | 3-amino-2-(2,4-dimethoxyphenyl)phenol;hydrochloride |
|---|---|
| PubChem CID | 22173838 |
| Molecular Formula | C14H16ClNO3 |
| Molecular Weight | 281.74 g/mol |
| Exact Mass | 281.08 |
| IUPAC Name | 3-amino-2-(2,4-dimethoxyphenyl)phenol;hydrochloride |
| SMILES | COc1ccc(-c2c(N)cccc2O)c(OC)c1.Cl |
| InChI | InChI=1S/C14H15NO3.ClH/c1-17-9-6-7-10(13(8-9)18-2)14-11(15)4-3-5-12(14)16;/h3-8,16H,15H2,1-2H3;1H |
| InChIKey | SRZNBAAUTXQOFH-UHFFFAOYSA-N |
| XLogP | 3.08 |
| TPSA | 64.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 281.74 |
| LogP ≤ 5 | 3.08 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|