C11H11NO3S — CID 116889764
2-(2,4-dimethoxyphenyl)-1,3-thiazol-4-ol (PubChem CID 116889764) has the molecular formula C11H11NO3S and a molecular weight of 237.28 g/mol. Its IUPAC name is 2-(2,4-dimethoxyphenyl)-1,3-thiazol-4-ol.
| Compound Name | 2-(2,4-dimethoxyphenyl)-1,3-thiazol-4-ol |
|---|---|
| PubChem CID | 116889764 |
| Molecular Formula | C11H11NO3S |
| Molecular Weight | 237.28 g/mol |
| Exact Mass | 237.05 |
| IUPAC Name | 2-(2,4-dimethoxyphenyl)-1,3-thiazol-4-ol |
| SMILES | COc1ccc(-c2nc(O)cs2)c(OC)c1 |
| InChI | InChI=1S/C11H11NO3S/c1-14-7-3-4-8(9(5-7)15-2)11-12-10(13)6-16-11/h3-6,13H,1-2H3 |
| InChIKey | JROGPHMMLLJJLQ-UHFFFAOYSA-N |
| XLogP | 2.53 |
| TPSA | 51.58 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 237.28 |
| LogP ≤ 5 | 2.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |