C12H13NO3S — CID 39354147
[2-(2,5-dimethoxyphenyl)-1,3-thiazol-4-yl]methanol (PubChem CID 39354147) has the molecular formula C12H13NO3S and a molecular weight of 251.31 g/mol. Its IUPAC name is [2-(2,5-dimethoxyphenyl)-1,3-thiazol-4-yl]methanol.
| Compound Name | [2-(2,5-dimethoxyphenyl)-1,3-thiazol-4-yl]methanol |
|---|---|
| PubChem CID | 39354147 |
| Molecular Formula | C12H13NO3S |
| Molecular Weight | 251.31 g/mol |
| Exact Mass | 251.06 |
| IUPAC Name | [2-(2,5-dimethoxyphenyl)-1,3-thiazol-4-yl]methanol |
| SMILES | COc1ccc(OC)c(-c2nc(CO)cs2)c1 |
| InChI | InChI=1S/C12H13NO3S/c1-15-9-3-4-11(16-2)10(5-9)12-13-8(6-14)7-17-12/h3-5,7,14H,6H2,1-2H3 |
| InChIKey | JUKMOMKYFCORRZ-UHFFFAOYSA-N |
| XLogP | 2.32 |
| TPSA | 51.58 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 251.31 |
| LogP ≤ 5 | 2.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |