C15H20N2O2S — CID 64544101
1-[2-(2,5-dimethoxyphenyl)-1,3-thiazol-4-yl]-N-ethylethanamine (PubChem CID 64544101) has the molecular formula C15H20N2O2S and a molecular weight of 292.40 g/mol. Its IUPAC name is 1-[2-(2,5-dimethoxyphenyl)-1,3-thiazol-4-yl]-N-ethylethanamine.
| Compound Name | 1-[2-(2,5-dimethoxyphenyl)-1,3-thiazol-4-yl]-N-ethylethanamine |
|---|---|
| PubChem CID | 64544101 |
| Molecular Formula | C15H20N2O2S |
| Molecular Weight | 292.40 g/mol |
| Exact Mass | 292.12 |
| IUPAC Name | 1-[2-(2,5-dimethoxyphenyl)-1,3-thiazol-4-yl]-N-ethylethanamine |
| SMILES | CCNC(C)c1csc(-c2cc(OC)ccc2OC)n1 |
| InChI | InChI=1S/C15H20N2O2S/c1-5-16-10(2)13-9-20-15(17-13)12-8-11(18-3)6-7-14(12)19-4/h6-10,16H,5H2,1-4H3 |
| InChIKey | MQCVDIIGUFAGCF-UHFFFAOYSA-N |
| XLogP | 3.50 |
| TPSA | 43.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.40 |
| LogP ≤ 5 | 3.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |