C11H12N2O2S — CID 675262
4-(2,5-dimethoxyphenyl)-1,3-thiazol-2-amine (PubChem CID 675262) has the molecular formula C11H12N2O2S and a molecular weight of 236.30 g/mol. Its IUPAC name is 4-(2,5-dimethoxyphenyl)-1,3-thiazol-2-amine.
| Compound Name | 4-(2,5-dimethoxyphenyl)-1,3-thiazol-2-amine |
|---|---|
| PubChem CID | 675262 |
| Molecular Formula | C11H12N2O2S |
| Molecular Weight | 236.30 g/mol |
| Exact Mass | 236.06 |
| IUPAC Name | 4-(2,5-dimethoxyphenyl)-1,3-thiazol-2-amine |
| SMILES | COc1ccc(OC)c(-c2csc(N)n2)c1 |
| InChI | InChI=1S/C11H12N2O2S/c1-14-7-3-4-10(15-2)8(5-7)9-6-16-11(12)13-9/h3-6H,1-2H3,(H2,12,13) |
| InChIKey | FXGVKHSZIMCUTR-UHFFFAOYSA-N |
| XLogP | 2.41 |
| TPSA | 57.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 236.30 |
| LogP ≤ 5 | 2.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |