C15H14N2O4S — CID 43817550
1-[4-(2,5-dimethoxyphenyl)-1,3-thiazol-2-yl]pyrrolidine-2,5-dione (PubChem CID 43817550) has the molecular formula C15H14N2O4S and a molecular weight of 318.35 g/mol. Its IUPAC name is 1-[4-(2,5-dimethoxyphenyl)-1,3-thiazol-2-yl]pyrrolidine-2,5-dione.
| Compound Name | 1-[4-(2,5-dimethoxyphenyl)-1,3-thiazol-2-yl]pyrrolidine-2,5-dione |
|---|---|
| PubChem CID | 43817550 |
| Molecular Formula | C15H14N2O4S |
| Molecular Weight | 318.35 g/mol |
| Exact Mass | 318.07 |
| IUPAC Name | 1-[4-(2,5-dimethoxyphenyl)-1,3-thiazol-2-yl]pyrrolidine-2,5-dione |
| SMILES | COc1ccc(OC)c(-c2csc(N3C(=O)CCC3=O)n2)c1 |
| InChI | InChI=1S/C15H14N2O4S/c1-20-9-3-4-12(21-2)10(7-9)11-8-22-15(16-11)17-13(18)5-6-14(17)19/h3-4,7-8H,5-6H2,1-2H3 |
| InChIKey | ZWEZOUCHOFTBHX-UHFFFAOYSA-N |
| XLogP | 2.48 |
| TPSA | 68.73 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.35 |
| LogP ≤ 5 | 2.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|