C21H19N5O6S2 — CID 137174992
4-[[2-[4-(2,5-dimethoxyphenyl)-1,3-thiazol-2-yl]-5-methyl-3-oxo-1H-pyrazol-4-yl]diazenyl]benzenesulfonic acid (PubChem CID 137174992) has the molecular formula C21H19N5O6S2 and a molecular weight of 501.55 g/mol. Its IUPAC name is 4-[[2-[4-(2,5-dimethoxyphenyl)-1,3-thiazol-2-yl]-5-methyl-3-oxo-1H-pyrazol-4-yl]diazenyl]benzenesulfonic acid.
| Compound Name | 4-[[2-[4-(2,5-dimethoxyphenyl)-1,3-thiazol-2-yl]-5-methyl-3-oxo-1H-pyrazol-4-yl]diazenyl]benzenesulfonic acid |
|---|---|
| PubChem CID | 137174992 |
| Molecular Formula | C21H19N5O6S2 |
| Molecular Weight | 501.55 g/mol |
| Exact Mass | 501.08 |
| IUPAC Name | 4-[[2-[4-(2,5-dimethoxyphenyl)-1,3-thiazol-2-yl]-5-methyl-3-oxo-1H-pyrazol-4-yl]diazenyl]benzenesulfonic acid |
| SMILES | COc1ccc(OC)c(-c2csc(-n3[nH]c(C)c(/N=N/c4ccc(S(=O)(=O)O)cc4)c3=O)n2)c1 |
| InChI | InChI=1S/C21H19N5O6S2/c1-12-19(24-23-13-4-7-15(8-5-13)34(28,29)30)20(27)26(25-12)21-22-17(11-33-21)16-10-14(31-2)6-9-18(16)32-3/h4-11,25H,1-3H3,(H,28,29,30)/b24-23+ |
| InChIKey | MWWROPYYIQDEME-WCWDXBQESA-N |
| XLogP | 4.28 |
| TPSA | 148.23 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 501.55 |
| LogP ≤ 5 | 4.28 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|