C21H17N5O3S — CID 4311906
4-[[5-methyl-2-[4-(4-methylphenyl)-1,3-thiazol-2-yl]-3-oxo-1H-pyrazol-4-yl]diazenyl]benzoic acid (PubChem CID 4311906) has the molecular formula C21H17N5O3S and a molecular weight of 419.47 g/mol. Its IUPAC name is 4-[[5-methyl-2-[4-(4-methylphenyl)-1,3-thiazol-2-yl]-3-oxo-1H-pyrazol-4-yl]diazenyl]benzoic acid.
| Compound Name | 4-[[5-methyl-2-[4-(4-methylphenyl)-1,3-thiazol-2-yl]-3-oxo-1H-pyrazol-4-yl]diazenyl]benzoic acid |
|---|---|
| PubChem CID | 4311906 |
| Molecular Formula | C21H17N5O3S |
| Molecular Weight | 419.47 g/mol |
| Exact Mass | 419.11 |
| IUPAC Name | 4-[[5-methyl-2-[4-(4-methylphenyl)-1,3-thiazol-2-yl]-3-oxo-1H-pyrazol-4-yl]diazenyl]benzoic acid |
| SMILES | Cc1ccc(-c2csc(-n3[nH]c(C)c(/N=N/c4ccc(C(=O)O)cc4)c3=O)n2)cc1 |
| InChI | InChI=1S/C21H17N5O3S/c1-12-3-5-14(6-4-12)17-11-30-21(22-17)26-19(27)18(13(2)25-26)24-23-16-9-7-15(8-10-16)20(28)29/h3-11,25H,1-2H3,(H,28,29)/b24-23+ |
| InChIKey | PSHZTCULLBPZNZ-WCWDXBQESA-N |
| XLogP | 5.02 |
| TPSA | 112.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.47 |
| LogP ≤ 5 | 5.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'} |
|---|