C23H16N6O3S2 — CID 142488266
4-[2-[4-[(4-methyl-1,3-thiazol-2-yl)diazenyl]-3-oxo-5-phenyl-1H-pyrazol-2-yl]-1,3-thiazol-4-yl]benzoic acid (PubChem CID 142488266) has the molecular formula C23H16N6O3S2 and a molecular weight of 488.55 g/mol. Its IUPAC name is 4-[2-[4-[(4-methyl-1,3-thiazol-2-yl)diazenyl]-3-oxo-5-phenyl-1H-pyrazol-2-yl]-1,3-thiazol-4-yl]benzoic acid.
| Compound Name | 4-[2-[4-[(4-methyl-1,3-thiazol-2-yl)diazenyl]-3-oxo-5-phenyl-1H-pyrazol-2-yl]-1,3-thiazol-4-yl]benzoic acid |
|---|---|
| PubChem CID | 142488266 |
| Molecular Formula | C23H16N6O3S2 |
| Molecular Weight | 488.55 g/mol |
| Exact Mass | 488.07 |
| IUPAC Name | 4-[2-[4-[(4-methyl-1,3-thiazol-2-yl)diazenyl]-3-oxo-5-phenyl-1H-pyrazol-2-yl]-1,3-thiazol-4-yl]benzoic acid |
| SMILES | Cc1csc(/N=N/c2c(-c3ccccc3)[nH]n(-c3nc(-c4ccc(C(=O)O)cc4)cs3)c2=O)n1 |
| InChI | InChI=1S/C23H16N6O3S2/c1-13-11-33-22(24-13)27-26-19-18(15-5-3-2-4-6-15)28-29(20(19)30)23-25-17(12-34-23)14-7-9-16(10-8-14)21(31)32/h2-12,28H,1H3,(H,31,32)/b27-26+ |
| InChIKey | XJACQARLDUZAFO-CYYJNZCTSA-N |
| XLogP | 5.83 |
| TPSA | 125.59 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 488.55 |
| LogP ≤ 5 | 5.83 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'} |
|---|