C26H19N5O3S — CID 142488292
methyl 2-[[3-oxo-5-phenyl-2-(4-phenyl-1,3-thiazol-2-yl)-1H-pyrazol-4-yl]diazenyl]benzoate (PubChem CID 142488292) has the molecular formula C26H19N5O3S and a molecular weight of 481.54 g/mol. Its IUPAC name is methyl 2-[[3-oxo-5-phenyl-2-(4-phenyl-1,3-thiazol-2-yl)-1H-pyrazol-4-yl]diazenyl]benzoate.
| Compound Name | methyl 2-[[3-oxo-5-phenyl-2-(4-phenyl-1,3-thiazol-2-yl)-1H-pyrazol-4-yl]diazenyl]benzoate |
|---|---|
| PubChem CID | 142488292 |
| Molecular Formula | C26H19N5O3S |
| Molecular Weight | 481.54 g/mol |
| Exact Mass | 481.12 |
| IUPAC Name | methyl 2-[[3-oxo-5-phenyl-2-(4-phenyl-1,3-thiazol-2-yl)-1H-pyrazol-4-yl]diazenyl]benzoate |
| SMILES | COC(=O)c1ccccc1/N=N/c1c(-c2ccccc2)[nH]n(-c2nc(-c3ccccc3)cs2)c1=O |
| InChI | InChI=1S/C26H19N5O3S/c1-34-25(33)19-14-8-9-15-20(19)28-29-23-22(18-12-6-3-7-13-18)30-31(24(23)32)26-27-21(16-35-26)17-10-4-2-5-11-17/h2-16,30H,1H3/b29-28+ |
| InChIKey | MKXMXMVNNMSRDC-ZQHSETAFSA-N |
| XLogP | 6.16 |
| TPSA | 101.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 481.54 |
| LogP ≤ 5 | 6.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'} |
|---|