C26H20BrN5O2S — CID 3332411
4-[(3-bromo-4-methylphenyl)diazenyl]-2-[4-(4-methoxyphenyl)-1,3-thiazol-2-yl]-5-phenyl-1H-pyrazol-3-one (PubChem CID 3332411) has the molecular formula C26H20BrN5O2S and a molecular weight of 546.45 g/mol. Its IUPAC name is 4-[(3-bromo-4-methylphenyl)diazenyl]-2-[4-(4-methoxyphenyl)-1,3-thiazol-2-yl]-5-phenyl-1H-pyrazol-3-one.
| Compound Name | 4-[(3-bromo-4-methylphenyl)diazenyl]-2-[4-(4-methoxyphenyl)-1,3-thiazol-2-yl]-5-phenyl-1H-pyrazol-3-one |
|---|---|
| PubChem CID | 3332411 |
| Molecular Formula | C26H20BrN5O2S |
| Molecular Weight | 546.45 g/mol |
| Exact Mass | 545.05 |
| IUPAC Name | 4-[(3-bromo-4-methylphenyl)diazenyl]-2-[4-(4-methoxyphenyl)-1,3-thiazol-2-yl]-5-phenyl-1H-pyrazol-3-one |
| SMILES | COc1ccc(-c2csc(-n3[nH]c(-c4ccccc4)c(/N=N/c4ccc(C)c(Br)c4)c3=O)n2)cc1 |
| InChI | InChI=1S/C26H20BrN5O2S/c1-16-8-11-19(14-21(16)27)29-30-24-23(18-6-4-3-5-7-18)31-32(25(24)33)26-28-22(15-35-26)17-9-12-20(34-2)13-10-17/h3-15,31H,1-2H3/b30-29+ |
| InChIKey | OWUPUTSEKYZOIA-QVIHXGFCSA-N |
| XLogP | 7.45 |
| TPSA | 84.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 546.45 |
| LogP ≤ 5 | 7.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'} |
|---|