C22H14N6O3S2 — CID 142488271
2-[[3-oxo-5-phenyl-2-(4-phenyl-1,3-thiazol-2-yl)-1H-pyrazol-4-yl]diazenyl]-1,3-thiazole-4-carboxylic acid (PubChem CID 142488271) has the molecular formula C22H14N6O3S2 and a molecular weight of 474.53 g/mol. Its IUPAC name is 2-[[3-oxo-5-phenyl-2-(4-phenyl-1,3-thiazol-2-yl)-1H-pyrazol-4-yl]diazenyl]-1,3-thiazole-4-carboxylic acid.
| Compound Name | 2-[[3-oxo-5-phenyl-2-(4-phenyl-1,3-thiazol-2-yl)-1H-pyrazol-4-yl]diazenyl]-1,3-thiazole-4-carboxylic acid |
|---|---|
| PubChem CID | 142488271 |
| Molecular Formula | C22H14N6O3S2 |
| Molecular Weight | 474.53 g/mol |
| Exact Mass | 474.06 |
| IUPAC Name | 2-[[3-oxo-5-phenyl-2-(4-phenyl-1,3-thiazol-2-yl)-1H-pyrazol-4-yl]diazenyl]-1,3-thiazole-4-carboxylic acid |
| SMILES | O=C(O)c1csc(/N=N/c2c(-c3ccccc3)[nH]n(-c3nc(-c4ccccc4)cs3)c2=O)n1 |
| InChI | InChI=1S/C22H14N6O3S2/c29-19-18(25-26-21-23-16(12-32-21)20(30)31)17(14-9-5-2-6-10-14)27-28(19)22-24-15(11-33-22)13-7-3-1-4-8-13/h1-12,27H,(H,30,31)/b26-25+ |
| InChIKey | AGPHHMIKIUYZFO-OCEACIFDSA-N |
| XLogP | 5.53 |
| TPSA | 125.59 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 474.53 |
| LogP ≤ 5 | 5.53 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'} |
|---|