C20H14N5O3S- — CID 135830981
4-[[5-methyl-3-oxo-2-(4-phenyl-1,3-thiazol-2-yl)-1H-pyrazol-4-yl]diazenyl]benzoate (PubChem CID 135830981) has the molecular formula C20H14N5O3S- and a molecular weight of 404.43 g/mol. Its IUPAC name is 4-[[5-methyl-3-oxo-2-(4-phenyl-1,3-thiazol-2-yl)-1H-pyrazol-4-yl]diazenyl]benzoate.
| Compound Name | 4-[[5-methyl-3-oxo-2-(4-phenyl-1,3-thiazol-2-yl)-1H-pyrazol-4-yl]diazenyl]benzoate |
|---|---|
| PubChem CID | 135830981 |
| Molecular Formula | C20H14N5O3S- |
| Molecular Weight | 404.43 g/mol |
| Exact Mass | 404.08 |
| IUPAC Name | 4-[[5-methyl-3-oxo-2-(4-phenyl-1,3-thiazol-2-yl)-1H-pyrazol-4-yl]diazenyl]benzoate |
| SMILES | Cc1[nH]n(-c2nc(-c3ccccc3)cs2)c(=O)c1/N=N/c1ccc(C(=O)[O-])cc1 |
| InChI | InChI=1S/C20H15N5O3S/c1-12-17(23-22-15-9-7-14(8-10-15)19(27)28)18(26)25(24-12)20-21-16(11-29-20)13-5-3-2-4-6-13/h2-11,24H,1H3,(H,27,28)/p-1/b23-22+ |
| InChIKey | ZPUBGAGRUCHQAY-GHVJWSGMSA-M |
| XLogP | 3.38 |
| TPSA | 115.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.43 |
| LogP ≤ 5 | 3.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'} |
|---|