C19H13N7O5S — CID 3939931
5-methyl-4-[(4-nitrophenyl)diazenyl]-2-[4-(3-nitrophenyl)-1,3-thiazol-2-yl]-1H-pyrazol-3-one (PubChem CID 3939931) has the molecular formula C19H13N7O5S and a molecular weight of 451.42 g/mol. Its IUPAC name is 5-methyl-4-[(4-nitrophenyl)diazenyl]-2-[4-(3-nitrophenyl)-1,3-thiazol-2-yl]-1H-pyrazol-3-one.
| Compound Name | 5-methyl-4-[(4-nitrophenyl)diazenyl]-2-[4-(3-nitrophenyl)-1,3-thiazol-2-yl]-1H-pyrazol-3-one |
|---|---|
| PubChem CID | 3939931 |
| Molecular Formula | C19H13N7O5S |
| Molecular Weight | 451.42 g/mol |
| Exact Mass | 451.07 |
| IUPAC Name | 5-methyl-4-[(4-nitrophenyl)diazenyl]-2-[4-(3-nitrophenyl)-1,3-thiazol-2-yl]-1H-pyrazol-3-one |
| SMILES | Cc1[nH]n(-c2nc(-c3cccc([N+](=O)[O-])c3)cs2)c(=O)c1/N=N/c1ccc([N+](=O)[O-])cc1 |
| InChI | InChI=1S/C19H13N7O5S/c1-11-17(22-21-13-5-7-14(8-6-13)25(28)29)18(27)24(23-11)19-20-16(10-32-19)12-3-2-4-15(9-12)26(30)31/h2-10,23H,1H3/b22-21+ |
| InChIKey | OHNJMOXVLIOKDQ-QURGRASLSA-N |
| XLogP | 4.83 |
| TPSA | 161.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 451.42 |
| LogP ≤ 5 | 4.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|