C19H12Cl2N6O3S — CID 3601915
4-[(4-chloro-3-nitrophenyl)diazenyl]-2-[4-(4-chlorophenyl)-1,3-thiazol-2-yl]-5-methyl-1H-pyrazol-3-one (PubChem CID 3601915) has the molecular formula C19H12Cl2N6O3S and a molecular weight of 475.32 g/mol. Its IUPAC name is 4-[(4-chloro-3-nitrophenyl)diazenyl]-2-[4-(4-chlorophenyl)-1,3-thiazol-2-yl]-5-methyl-1H-pyrazol-3-one.
| Compound Name | 4-[(4-chloro-3-nitrophenyl)diazenyl]-2-[4-(4-chlorophenyl)-1,3-thiazol-2-yl]-5-methyl-1H-pyrazol-3-one |
|---|---|
| PubChem CID | 3601915 |
| Molecular Formula | C19H12Cl2N6O3S |
| Molecular Weight | 475.32 g/mol |
| Exact Mass | 474.01 |
| IUPAC Name | 4-[(4-chloro-3-nitrophenyl)diazenyl]-2-[4-(4-chlorophenyl)-1,3-thiazol-2-yl]-5-methyl-1H-pyrazol-3-one |
| SMILES | Cc1[nH]n(-c2nc(-c3ccc(Cl)cc3)cs2)c(=O)c1/N=N/c1ccc(Cl)c([N+](=O)[O-])c1 |
| InChI | InChI=1S/C19H12Cl2N6O3S/c1-10-17(24-23-13-6-7-14(21)16(8-13)27(29)30)18(28)26(25-10)19-22-15(9-31-19)11-2-4-12(20)5-3-11/h2-9,25H,1H3/b24-23+ |
| InChIKey | UALFTRFVKZYQTL-WCWDXBQESA-N |
| XLogP | 6.23 |
| TPSA | 118.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 475.32 |
| LogP ≤ 5 | 6.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|