C19H13BrFN5OS — CID 3988169
2-[4-(4-bromophenyl)-1,3-thiazol-2-yl]-4-[(4-fluorophenyl)diazenyl]-5-methyl-1H-pyrazol-3-one (PubChem CID 3988169) has the molecular formula C19H13BrFN5OS and a molecular weight of 458.32 g/mol. Its IUPAC name is 2-[4-(4-bromophenyl)-1,3-thiazol-2-yl]-4-[(4-fluorophenyl)diazenyl]-5-methyl-1H-pyrazol-3-one.
| Compound Name | 2-[4-(4-bromophenyl)-1,3-thiazol-2-yl]-4-[(4-fluorophenyl)diazenyl]-5-methyl-1H-pyrazol-3-one |
|---|---|
| PubChem CID | 3988169 |
| Molecular Formula | C19H13BrFN5OS |
| Molecular Weight | 458.32 g/mol |
| Exact Mass | 457.00 |
| IUPAC Name | 2-[4-(4-bromophenyl)-1,3-thiazol-2-yl]-4-[(4-fluorophenyl)diazenyl]-5-methyl-1H-pyrazol-3-one |
| SMILES | Cc1[nH]n(-c2nc(-c3ccc(Br)cc3)cs2)c(=O)c1/N=N/c1ccc(F)cc1 |
| InChI | InChI=1S/C19H13BrFN5OS/c1-11-17(24-23-15-8-6-14(21)7-9-15)18(27)26(25-11)19-22-16(10-28-19)12-2-4-13(20)5-3-12/h2-10,25H,1H3/b24-23+ |
| InChIKey | TZRKANSPMRTODI-WCWDXBQESA-N |
| XLogP | 5.91 |
| TPSA | 75.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 458.32 |
| LogP ≤ 5 | 5.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'} |
|---|