C23H18N4O3 — CID 163347408
4-[[2-(4-methylphenyl)-3-oxo-5-phenyl-1H-pyrazol-4-yl]diazenyl]benzoic acid (PubChem CID 163347408) has the molecular formula C23H18N4O3 and a molecular weight of 398.42 g/mol. Its IUPAC name is 4-[[2-(4-methylphenyl)-3-oxo-5-phenyl-1H-pyrazol-4-yl]diazenyl]benzoic acid.
| Compound Name | 4-[[2-(4-methylphenyl)-3-oxo-5-phenyl-1H-pyrazol-4-yl]diazenyl]benzoic acid |
|---|---|
| PubChem CID | 163347408 |
| Molecular Formula | C23H18N4O3 |
| Molecular Weight | 398.42 g/mol |
| Exact Mass | 398.14 |
| IUPAC Name | 4-[[2-(4-methylphenyl)-3-oxo-5-phenyl-1H-pyrazol-4-yl]diazenyl]benzoic acid |
| SMILES | Cc1ccc(-n2[nH]c(-c3ccccc3)c(/N=N/c3ccc(C(=O)O)cc3)c2=O)cc1 |
| InChI | InChI=1S/C23H18N4O3/c1-15-7-13-19(14-8-15)27-22(28)21(20(26-27)16-5-3-2-4-6-16)25-24-18-11-9-17(10-12-18)23(29)30/h2-14,26H,1H3,(H,29,30)/b25-24+ |
| InChIKey | BHGODVGMCDMTMT-OCOZRVBESA-N |
| XLogP | 5.25 |
| TPSA | 99.81 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.42 |
| LogP ≤ 5 | 5.25 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'} |
|---|