C22H16N6O4 — CID 3109388
4-[[5-(4-nitrophenyl)-3-oxo-2-phenyl-1H-pyrazol-4-yl]diazenyl]benzamide (PubChem CID 3109388) has the molecular formula C22H16N6O4 and a molecular weight of 428.41 g/mol. Its IUPAC name is 4-[[5-(4-nitrophenyl)-3-oxo-2-phenyl-1H-pyrazol-4-yl]diazenyl]benzamide.
| Compound Name | 4-[[5-(4-nitrophenyl)-3-oxo-2-phenyl-1H-pyrazol-4-yl]diazenyl]benzamide |
|---|---|
| PubChem CID | 3109388 |
| Molecular Formula | C22H16N6O4 |
| Molecular Weight | 428.41 g/mol |
| Exact Mass | 428.12 |
| IUPAC Name | 4-[[5-(4-nitrophenyl)-3-oxo-2-phenyl-1H-pyrazol-4-yl]diazenyl]benzamide |
| SMILES | NC(=O)c1ccc(/N=N/c2c(-c3ccc([N+](=O)[O-])cc3)[nH]n(-c3ccccc3)c2=O)cc1 |
| InChI | InChI=1S/C22H16N6O4/c23-21(29)15-6-10-16(11-7-15)24-25-20-19(14-8-12-18(13-9-14)28(31)32)26-27(22(20)30)17-4-2-1-3-5-17/h1-13,26H,(H2,23,29)/b25-24+ |
| InChIKey | UDBQUUYFLUBCAA-OCOZRVBESA-N |
| XLogP | 4.26 |
| TPSA | 148.74 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.41 |
| LogP ≤ 5 | 4.26 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|