C27H20N6O — CID 3109349
2,5-diphenyl-4-[(4-phenyldiazenylphenyl)diazenyl]-1H-pyrazol-3-one (PubChem CID 3109349) has the molecular formula C27H20N6O and a molecular weight of 444.50 g/mol. Its IUPAC name is 2,5-diphenyl-4-[(4-phenyldiazenylphenyl)diazenyl]-1H-pyrazol-3-one.
| Compound Name | 2,5-diphenyl-4-[(4-phenyldiazenylphenyl)diazenyl]-1H-pyrazol-3-one |
|---|---|
| PubChem CID | 3109349 |
| Molecular Formula | C27H20N6O |
| Molecular Weight | 444.50 g/mol |
| Exact Mass | 444.17 |
| IUPAC Name | 2,5-diphenyl-4-[(4-phenyldiazenylphenyl)diazenyl]-1H-pyrazol-3-one |
| SMILES | O=c1c(/N=N/c2ccc(/N=N/c3ccccc3)cc2)c(-c2ccccc2)[nH]n1-c1ccccc1 |
| InChI | InChI=1S/C27H20N6O/c34-27-26(25(20-10-4-1-5-11-20)32-33(27)24-14-8-3-9-15-24)31-30-23-18-16-22(17-19-23)29-28-21-12-6-2-7-13-21/h1-19,32H/b29-28+,31-30+ |
| InChIKey | GJGIWJRUVWQNAG-DUJDKOHPSA-N |
| XLogP | 7.66 |
| TPSA | 87.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 444.50 |
| LogP ≤ 5 | 7.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'} |
|---|