C24H20N4O3 — CID 3109345
ethyl 4-[(3-oxo-2,5-diphenyl-1H-pyrazol-4-yl)diazenyl]benzoate (PubChem CID 3109345) has the molecular formula C24H20N4O3 and a molecular weight of 412.45 g/mol. Its IUPAC name is ethyl 4-[(3-oxo-2,5-diphenyl-1H-pyrazol-4-yl)diazenyl]benzoate.
| Compound Name | ethyl 4-[(3-oxo-2,5-diphenyl-1H-pyrazol-4-yl)diazenyl]benzoate |
|---|---|
| PubChem CID | 3109345 |
| Molecular Formula | C24H20N4O3 |
| Molecular Weight | 412.45 g/mol |
| Exact Mass | 412.15 |
| IUPAC Name | ethyl 4-[(3-oxo-2,5-diphenyl-1H-pyrazol-4-yl)diazenyl]benzoate |
| SMILES | CCOC(=O)c1ccc(/N=N/c2c(-c3ccccc3)[nH]n(-c3ccccc3)c2=O)cc1 |
| InChI | InChI=1S/C24H20N4O3/c1-2-31-24(30)18-13-15-19(16-14-18)25-26-22-21(17-9-5-3-6-10-17)27-28(23(22)29)20-11-7-4-8-12-20/h3-16,27H,2H2,1H3/b26-25+ |
| InChIKey | XANXIHQXBJEQIV-OCEACIFDSA-N |
| XLogP | 5.42 |
| TPSA | 88.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.45 |
| LogP ≤ 5 | 5.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'} |
|---|