C13H14N4O3 — CID 4078979
ethyl 4-[(3-methyl-5-oxo-1,2-dihydropyrazol-4-yl)diazenyl]benzoate (PubChem CID 4078979) has the molecular formula C13H14N4O3 and a molecular weight of 274.28 g/mol. Its IUPAC name is ethyl 4-[(3-methyl-5-oxo-1,2-dihydropyrazol-4-yl)diazenyl]benzoate.
| Compound Name | ethyl 4-[(3-methyl-5-oxo-1,2-dihydropyrazol-4-yl)diazenyl]benzoate |
|---|---|
| PubChem CID | 4078979 |
| Molecular Formula | C13H14N4O3 |
| Molecular Weight | 274.28 g/mol |
| Exact Mass | 274.11 |
| IUPAC Name | ethyl 4-[(3-methyl-5-oxo-1,2-dihydropyrazol-4-yl)diazenyl]benzoate |
| SMILES | CCOC(=O)c1ccc(/N=N/c2c(C)[nH][nH]c2=O)cc1 |
| InChI | InChI=1S/C13H14N4O3/c1-3-20-13(19)9-4-6-10(7-5-9)15-16-11-8(2)14-17-12(11)18/h4-7H,3H2,1-2H3,(H2,14,17,18)/b16-15+ |
| InChIKey | IVZMCXIZDOTDFP-FOCLMDBBSA-N |
| XLogP | 2.60 |
| TPSA | 99.67 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.28 |
| LogP ≤ 5 | 2.60 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'} |
|---|