C13H17N3O2 — CID 139203232
ethyl 4-(pyrrolidin-1-yldiazenyl)benzoate (PubChem CID 139203232) has the molecular formula C13H17N3O2 and a molecular weight of 247.30 g/mol. Its IUPAC name is ethyl 4-(pyrrolidin-1-yldiazenyl)benzoate.
| Compound Name | ethyl 4-(pyrrolidin-1-yldiazenyl)benzoate |
|---|---|
| PubChem CID | 139203232 |
| Molecular Formula | C13H17N3O2 |
| Molecular Weight | 247.30 g/mol |
| Exact Mass | 247.13 |
| IUPAC Name | ethyl 4-(pyrrolidin-1-yldiazenyl)benzoate |
| SMILES | CCOC(=O)c1ccc(/N=N/N2CCCC2)cc1 |
| InChI | InChI=1S/C13H17N3O2/c1-2-18-13(17)11-5-7-12(8-6-11)14-15-16-9-3-4-10-16/h5-8H,2-4,9-10H2,1H3/b15-14+ |
| InChIKey | NWRBLSMUAQPWOI-CCEZHUSRSA-N |
| XLogP | 2.96 |
| TPSA | 54.26 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 247.30 |
| LogP ≤ 5 | 2.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'} |
|---|