C31H44N8O4 — CID 101389079
ethyl 4-[[3-[[3-[(4-ethoxycarbonylphenyl)diazenyl]-6-ethyl-1,3-diazinan-1-yl]methyl]-4-ethyl-1,3-diazinan-1-yl]diazenyl]benzoate (PubChem CID 101389079) has the molecular formula C31H44N8O4 and a molecular weight of 592.75 g/mol. Its IUPAC name is ethyl 4-[[3-[[3-[(4-ethoxycarbonylphenyl)diazenyl]-6-ethyl-1,3-diazinan-1-yl]methyl]-4-ethyl-1,3-diazinan-1-yl]diazenyl]benzoate.
| Compound Name | ethyl 4-[[3-[[3-[(4-ethoxycarbonylphenyl)diazenyl]-6-ethyl-1,3-diazinan-1-yl]methyl]-4-ethyl-1,3-diazinan-1-yl]diazenyl]benzoate |
|---|---|
| PubChem CID | 101389079 |
| Molecular Formula | C31H44N8O4 |
| Molecular Weight | 592.75 g/mol |
| Exact Mass | 592.35 |
| IUPAC Name | ethyl 4-[[3-[[3-[(4-ethoxycarbonylphenyl)diazenyl]-6-ethyl-1,3-diazinan-1-yl]methyl]-4-ethyl-1,3-diazinan-1-yl]diazenyl]benzoate |
| SMILES | CCOC(=O)c1ccc(/N=N/N2CCC(CC)N(CN3CN(/N=N/c4ccc(C(=O)OCC)cc4)CCC3CC)C2)cc1 |
| InChI | InChI=1S/C31H44N8O4/c1-5-28-17-19-38(34-32-26-13-9-24(10-14-26)30(40)42-7-3)22-36(28)21-37-23-39(20-18-29(37)6-2)35-33-27-15-11-25(12-16-27)31(41)43-8-4/h9-16,28-29H,5-8,17-23H2,1-4H3/b34-32+,35-33+ |
| InChIKey | URMATCUCOWRLPS-XUXOKTBYSA-N |
| XLogP | 6.18 |
| TPSA | 115.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 592.75 |
| LogP ≤ 5 | 6.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'} |
|---|