C17H26N2O2 — CID 82165894
ethyl 3-amino-4-[(2-ethylpiperidin-1-yl)methyl]benzoate (PubChem CID 82165894) has the molecular formula C17H26N2O2 and a molecular weight of 290.41 g/mol. Its IUPAC name is ethyl 3-amino-4-[(2-ethylpiperidin-1-yl)methyl]benzoate.
| Compound Name | ethyl 3-amino-4-[(2-ethylpiperidin-1-yl)methyl]benzoate |
|---|---|
| PubChem CID | 82165894 |
| Molecular Formula | C17H26N2O2 |
| Molecular Weight | 290.41 g/mol |
| Exact Mass | 290.20 |
| IUPAC Name | ethyl 3-amino-4-[(2-ethylpiperidin-1-yl)methyl]benzoate |
| SMILES | CCOC(=O)c1ccc(CN2CCCCC2CC)c(N)c1 |
| InChI | InChI=1S/C17H26N2O2/c1-3-15-7-5-6-10-19(15)12-14-9-8-13(11-16(14)18)17(20)21-4-2/h8-9,11,15H,3-7,10,12,18H2,1-2H3 |
| InChIKey | APYSKSVGDKIFQW-UHFFFAOYSA-N |
| XLogP | 3.21 |
| TPSA | 55.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.41 |
| LogP ≤ 5 | 3.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|