C21H33N3O2S — CID 100686658
ethyl 3-[3-[(2S)-2-ethylpiperidin-1-yl]propylcarbamothioylamino]-4-methylbenzoate (PubChem CID 100686658) has the molecular formula C21H33N3O2S and a molecular weight of 391.58 g/mol. Its IUPAC name is ethyl 3-[3-[(2S)-2-ethylpiperidin-1-yl]propylcarbamothioylamino]-4-methylbenzoate.
| Compound Name | ethyl 3-[3-[(2S)-2-ethylpiperidin-1-yl]propylcarbamothioylamino]-4-methylbenzoate |
|---|---|
| PubChem CID | 100686658 |
| Molecular Formula | C21H33N3O2S |
| Molecular Weight | 391.58 g/mol |
| Exact Mass | 391.23 |
| IUPAC Name | ethyl 3-[3-[(2S)-2-ethylpiperidin-1-yl]propylcarbamothioylamino]-4-methylbenzoate |
| SMILES | CCOC(=O)c1ccc(C)c(NC(=S)NCCCN2CCCC[C@@H]2CC)c1 |
| InChI | InChI=1S/C21H33N3O2S/c1-4-18-9-6-7-13-24(18)14-8-12-22-21(27)23-19-15-17(11-10-16(19)3)20(25)26-5-2/h10-11,15,18H,4-9,12-14H2,1-3H3,(H2,22,23,27)/t18-/m0/s1 |
| InChIKey | BPZLRJJLVIASQI-SFHVURJKSA-N |
| XLogP | 4.11 |
| TPSA | 53.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.58 |
| LogP ≤ 5 | 4.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|