C18H26F3N3S — CID 100686423
1-[3-[(2S)-2-ethylpiperidin-1-yl]propyl]-3-[4-(trifluoromethyl)phenyl]thiourea (PubChem CID 100686423) has the molecular formula C18H26F3N3S and a molecular weight of 373.49 g/mol. Its IUPAC name is 1-[3-[(2S)-2-ethylpiperidin-1-yl]propyl]-3-[4-(trifluoromethyl)phenyl]thiourea.
| Compound Name | 1-[3-[(2S)-2-ethylpiperidin-1-yl]propyl]-3-[4-(trifluoromethyl)phenyl]thiourea |
|---|---|
| PubChem CID | 100686423 |
| Molecular Formula | C18H26F3N3S |
| Molecular Weight | 373.49 g/mol |
| Exact Mass | 373.18 |
| IUPAC Name | 1-[3-[(2S)-2-ethylpiperidin-1-yl]propyl]-3-[4-(trifluoromethyl)phenyl]thiourea |
| SMILES | CC[C@H]1CCCCN1CCCNC(=S)Nc1ccc(C(F)(F)F)cc1 |
| InChI | InChI=1S/C18H26F3N3S/c1-2-16-6-3-4-12-24(16)13-5-11-22-17(25)23-15-9-7-14(8-10-15)18(19,20)21/h7-10,16H,2-6,11-13H2,1H3,(H2,22,23,25)/t16-/m0/s1 |
| InChIKey | NBVJPQMXUSOUAE-INIZCTEOSA-N |
| XLogP | 4.65 |
| TPSA | 27.30 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.49 |
| LogP ≤ 5 | 4.65 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|