C20H31N3OS — CID 100686869
1-[3-[(2S)-2-ethylpiperidin-1-yl]propyl]-3-(3-prop-2-enoxyphenyl)thiourea (PubChem CID 100686869) has the molecular formula C20H31N3OS and a molecular weight of 361.56 g/mol. Its IUPAC name is 1-[3-[(2S)-2-ethylpiperidin-1-yl]propyl]-3-(3-prop-2-enoxyphenyl)thiourea.
| Compound Name | 1-[3-[(2S)-2-ethylpiperidin-1-yl]propyl]-3-(3-prop-2-enoxyphenyl)thiourea |
|---|---|
| PubChem CID | 100686869 |
| Molecular Formula | C20H31N3OS |
| Molecular Weight | 361.56 g/mol |
| Exact Mass | 361.22 |
| IUPAC Name | 1-[3-[(2S)-2-ethylpiperidin-1-yl]propyl]-3-(3-prop-2-enoxyphenyl)thiourea |
| SMILES | C=CCOc1cccc(NC(=S)NCCCN2CCCC[C@@H]2CC)c1 |
| InChI | InChI=1S/C20H31N3OS/c1-3-15-24-19-11-7-9-17(16-19)22-20(25)21-12-8-14-23-13-6-5-10-18(23)4-2/h3,7,9,11,16,18H,1,4-6,8,10,12-15H2,2H3,(H2,21,22,25)/t18-/m0/s1 |
| InChIKey | RLSGIBUQZIHJST-SFHVURJKSA-N |
| XLogP | 4.19 |
| TPSA | 36.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.56 |
| LogP ≤ 5 | 4.19 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|