C17H25BrClN3S — CID 100686441
1-(4-bromo-3-chlorophenyl)-3-[3-[(2S)-2-ethylpiperidin-1-yl]propyl]thiourea (PubChem CID 100686441) has the molecular formula C17H25BrClN3S and a molecular weight of 418.83 g/mol. Its IUPAC name is 1-(4-bromo-3-chlorophenyl)-3-[3-[(2S)-2-ethylpiperidin-1-yl]propyl]thiourea.
| Compound Name | 1-(4-bromo-3-chlorophenyl)-3-[3-[(2S)-2-ethylpiperidin-1-yl]propyl]thiourea |
|---|---|
| PubChem CID | 100686441 |
| Molecular Formula | C17H25BrClN3S |
| Molecular Weight | 418.83 g/mol |
| Exact Mass | 417.06 |
| IUPAC Name | 1-(4-bromo-3-chlorophenyl)-3-[3-[(2S)-2-ethylpiperidin-1-yl]propyl]thiourea |
| SMILES | CC[C@H]1CCCCN1CCCNC(=S)Nc1ccc(Br)c(Cl)c1 |
| InChI | InChI=1S/C17H25BrClN3S/c1-2-14-6-3-4-10-22(14)11-5-9-20-17(23)21-13-7-8-15(18)16(19)12-13/h7-8,12,14H,2-6,9-11H2,1H3,(H2,20,21,23)/t14-/m0/s1 |
| InChIKey | RRZNOIBJECVDHH-AWEZNQCLSA-N |
| XLogP | 5.04 |
| TPSA | 27.30 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.83 |
| LogP ≤ 5 | 5.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|