C19H28N4S — CID 100686164
1-[4-(cyanomethyl)phenyl]-3-[3-[(2S)-2-ethylpiperidin-1-yl]propyl]thiourea (PubChem CID 100686164) has the molecular formula C19H28N4S and a molecular weight of 344.53 g/mol. Its IUPAC name is 1-[4-(cyanomethyl)phenyl]-3-[3-[(2S)-2-ethylpiperidin-1-yl]propyl]thiourea.
| Compound Name | 1-[4-(cyanomethyl)phenyl]-3-[3-[(2S)-2-ethylpiperidin-1-yl]propyl]thiourea |
|---|---|
| PubChem CID | 100686164 |
| Molecular Formula | C19H28N4S |
| Molecular Weight | 344.53 g/mol |
| Exact Mass | 344.20 |
| IUPAC Name | 1-[4-(cyanomethyl)phenyl]-3-[3-[(2S)-2-ethylpiperidin-1-yl]propyl]thiourea |
| SMILES | CC[C@H]1CCCCN1CCCNC(=S)Nc1ccc(CC#N)cc1 |
| InChI | InChI=1S/C19H28N4S/c1-2-18-6-3-4-14-23(18)15-5-13-21-19(24)22-17-9-7-16(8-10-17)11-12-20/h7-10,18H,2-6,11,13-15H2,1H3,(H2,21,22,24)/t18-/m0/s1 |
| InChIKey | NPBWFHCGKTZUHU-SFHVURJKSA-N |
| XLogP | 3.69 |
| TPSA | 51.09 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.53 |
| LogP ≤ 5 | 3.69 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|