C18H26N4S — CID 100739088
1-[4-(cyanomethyl)phenyl]-3-[3-[(3R)-3-methylpiperidin-1-yl]propyl]thiourea (PubChem CID 100739088) has the molecular formula C18H26N4S and a molecular weight of 330.50 g/mol. Its IUPAC name is 1-[4-(cyanomethyl)phenyl]-3-[3-[(3R)-3-methylpiperidin-1-yl]propyl]thiourea.
| Compound Name | 1-[4-(cyanomethyl)phenyl]-3-[3-[(3R)-3-methylpiperidin-1-yl]propyl]thiourea |
|---|---|
| PubChem CID | 100739088 |
| Molecular Formula | C18H26N4S |
| Molecular Weight | 330.50 g/mol |
| Exact Mass | 330.19 |
| IUPAC Name | 1-[4-(cyanomethyl)phenyl]-3-[3-[(3R)-3-methylpiperidin-1-yl]propyl]thiourea |
| SMILES | C[C@@H]1CCCN(CCCNC(=S)Nc2ccc(CC#N)cc2)C1 |
| InChI | InChI=1S/C18H26N4S/c1-15-4-2-12-22(14-15)13-3-11-20-18(23)21-17-7-5-16(6-8-17)9-10-19/h5-8,15H,2-4,9,11-14H2,1H3,(H2,20,21,23)/t15-/m1/s1 |
| InChIKey | QLGYCFXHDCSUEK-OAHLLOKOSA-N |
| XLogP | 3.16 |
| TPSA | 51.09 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.50 |
| LogP ≤ 5 | 3.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|