C17H26BrN3S — CID 125048481
1-(4-bromo-3-methylphenyl)-3-[3-[(3S)-3-methylpiperidin-1-yl]propyl]thiourea (PubChem CID 125048481) has the molecular formula C17H26BrN3S and a molecular weight of 384.39 g/mol. Its IUPAC name is 1-(4-bromo-3-methylphenyl)-3-[3-[(3S)-3-methylpiperidin-1-yl]propyl]thiourea.
| Compound Name | 1-(4-bromo-3-methylphenyl)-3-[3-[(3S)-3-methylpiperidin-1-yl]propyl]thiourea |
|---|---|
| PubChem CID | 125048481 |
| Molecular Formula | C17H26BrN3S |
| Molecular Weight | 384.39 g/mol |
| Exact Mass | 383.10 |
| IUPAC Name | 1-(4-bromo-3-methylphenyl)-3-[3-[(3S)-3-methylpiperidin-1-yl]propyl]thiourea |
| SMILES | Cc1cc(NC(=S)NCCCN2CCC[C@H](C)C2)ccc1Br |
| InChI | InChI=1S/C17H26BrN3S/c1-13-5-3-9-21(12-13)10-4-8-19-17(22)20-15-6-7-16(18)14(2)11-15/h6-7,11,13H,3-5,8-10,12H2,1-2H3,(H2,19,20,22)/t13-/m0/s1 |
| InChIKey | NHIWLKWIWLRYSQ-ZDUSSCGKSA-N |
| XLogP | 4.17 |
| TPSA | 27.30 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.39 |
| LogP ≤ 5 | 4.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|