C17H27N3OS — CID 100738954
1-(3-methoxyphenyl)-3-[3-[(3R)-3-methylpiperidin-1-yl]propyl]thiourea (PubChem CID 100738954) has the molecular formula C17H27N3OS and a molecular weight of 321.49 g/mol. Its IUPAC name is 1-(3-methoxyphenyl)-3-[3-[(3R)-3-methylpiperidin-1-yl]propyl]thiourea.
| Compound Name | 1-(3-methoxyphenyl)-3-[3-[(3R)-3-methylpiperidin-1-yl]propyl]thiourea |
|---|---|
| PubChem CID | 100738954 |
| Molecular Formula | C17H27N3OS |
| Molecular Weight | 321.49 g/mol |
| Exact Mass | 321.19 |
| IUPAC Name | 1-(3-methoxyphenyl)-3-[3-[(3R)-3-methylpiperidin-1-yl]propyl]thiourea |
| SMILES | COc1cccc(NC(=S)NCCCN2CCC[C@@H](C)C2)c1 |
| InChI | InChI=1S/C17H27N3OS/c1-14-6-4-10-20(13-14)11-5-9-18-17(22)19-15-7-3-8-16(12-15)21-2/h3,7-8,12,14H,4-6,9-11,13H2,1-2H3,(H2,18,19,22)/t14-/m1/s1 |
| InChIKey | CHZIOKDGTTXSCT-CQSZACIVSA-N |
| XLogP | 3.10 |
| TPSA | 36.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.49 |
| LogP ≤ 5 | 3.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|