C16H23ClFN3S — CID 100739204
1-(3-chloro-4-fluorophenyl)-3-[3-[(3S)-3-methylpiperidin-1-yl]propyl]thiourea (PubChem CID 100739204) has the molecular formula C16H23ClFN3S and a molecular weight of 343.90 g/mol. Its IUPAC name is 1-(3-chloro-4-fluorophenyl)-3-[3-[(3S)-3-methylpiperidin-1-yl]propyl]thiourea.
| Compound Name | 1-(3-chloro-4-fluorophenyl)-3-[3-[(3S)-3-methylpiperidin-1-yl]propyl]thiourea |
|---|---|
| PubChem CID | 100739204 |
| Molecular Formula | C16H23ClFN3S |
| Molecular Weight | 343.90 g/mol |
| Exact Mass | 343.13 |
| IUPAC Name | 1-(3-chloro-4-fluorophenyl)-3-[3-[(3S)-3-methylpiperidin-1-yl]propyl]thiourea |
| SMILES | C[C@H]1CCCN(CCCNC(=S)Nc2ccc(F)c(Cl)c2)C1 |
| InChI | InChI=1S/C16H23ClFN3S/c1-12-4-2-8-21(11-12)9-3-7-19-16(22)20-13-5-6-15(18)14(17)10-13/h5-6,10,12H,2-4,7-9,11H2,1H3,(H2,19,20,22)/t12-/m0/s1 |
| InChIKey | JGIIHXXFSVPOGC-LBPRGKRZSA-N |
| XLogP | 3.89 |
| TPSA | 27.30 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.90 |
| LogP ≤ 5 | 3.89 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|