C19H30N4OS — CID 100739628
N,N-dimethyl-4-[3-[(3S)-3-methylpiperidin-1-yl]propylcarbamothioylamino]benzamide (PubChem CID 100739628) has the molecular formula C19H30N4OS and a molecular weight of 362.54 g/mol. Its IUPAC name is N,N-dimethyl-4-[3-[(3S)-3-methylpiperidin-1-yl]propylcarbamothioylamino]benzamide.
| Compound Name | N,N-dimethyl-4-[3-[(3S)-3-methylpiperidin-1-yl]propylcarbamothioylamino]benzamide |
|---|---|
| PubChem CID | 100739628 |
| Molecular Formula | C19H30N4OS |
| Molecular Weight | 362.54 g/mol |
| Exact Mass | 362.21 |
| IUPAC Name | N,N-dimethyl-4-[3-[(3S)-3-methylpiperidin-1-yl]propylcarbamothioylamino]benzamide |
| SMILES | C[C@H]1CCCN(CCCNC(=S)Nc2ccc(C(=O)N(C)C)cc2)C1 |
| InChI | InChI=1S/C19H30N4OS/c1-15-6-4-12-23(14-15)13-5-11-20-19(25)21-17-9-7-16(8-10-17)18(24)22(2)3/h7-10,15H,4-6,11-14H2,1-3H3,(H2,20,21,25)/t15-/m0/s1 |
| InChIKey | NVGZNJULWVAAKE-HNNXBMFYSA-N |
| XLogP | 2.80 |
| TPSA | 47.61 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.54 |
| LogP ≤ 5 | 2.80 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|