C19H30N4O3 — CID 87007007
methyl N-[4-[4-(3-methylpiperidin-1-yl)butylcarbamoylamino]phenyl]carbamate (PubChem CID 87007007) has the molecular formula C19H30N4O3 and a molecular weight of 362.47 g/mol. Its IUPAC name is methyl N-[4-[4-(3-methylpiperidin-1-yl)butylcarbamoylamino]phenyl]carbamate.
| Compound Name | methyl N-[4-[4-(3-methylpiperidin-1-yl)butylcarbamoylamino]phenyl]carbamate |
|---|---|
| PubChem CID | 87007007 |
| Molecular Formula | C19H30N4O3 |
| Molecular Weight | 362.47 g/mol |
| Exact Mass | 362.23 |
| IUPAC Name | methyl N-[4-[4-(3-methylpiperidin-1-yl)butylcarbamoylamino]phenyl]carbamate |
| SMILES | COC(=O)Nc1ccc(NC(=O)NCCCCN2CCCC(C)C2)cc1 |
| InChI | InChI=1S/C19H30N4O3/c1-15-6-5-13-23(14-15)12-4-3-11-20-18(24)21-16-7-9-17(10-8-16)22-19(25)26-2/h7-10,15H,3-6,11-14H2,1-2H3,(H,22,25)(H2,20,21,24) |
| InChIKey | UKOLUKIJSNFBHR-UHFFFAOYSA-N |
| XLogP | 3.50 |
| TPSA | 82.70 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.47 |
| LogP ≤ 5 | 3.50 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|